Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Zirconium(IV) fluoride, 99.9% (metals basis), Thermo Scientific Chemicals
CAS: 7783-64-4 MDL Number: MFCD00011307
| CAS | 7783-64-4 |
|---|---|
| MDL Number | MFCD00011307 |
Cupric Sulfate, Pentahydrate, Powder, USP, 98.5-100.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7758-99-8 Molecular Formula: CuH10O9S Molecular Weight (g/mol): 249.68 MDL Number: MFCD00149681 InChI Key: JZCCFEFSEZPSOG-UHFFFAOYSA-L IUPAC Name: copper(2+) pentahydrate sulfate SMILES: O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O
| CAS | 7758-99-8 |
|---|---|
| Molecular Weight (g/mol) | 249.68 |
| MDL Number | MFCD00149681 |
| SMILES | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O |
| IUPAC Name | copper(2+) pentahydrate sulfate |
| InChI Key | JZCCFEFSEZPSOG-UHFFFAOYSA-L |
| Molecular Formula | CuH10O9S |
Tantalum(V) oxide, 99.99%, (trace metal basis)
CAS: 1314-61-0 Molecular Formula: O5Ta2 Molecular Weight (g/mol): 441.89 MDL Number: MFCD00011254 InChI Key: PBCFLUZVCVVTBY-UHFFFAOYSA-N IUPAC Name: [(dioxotantalio)oxy]dioxotantalum SMILES: O=[Ta](=O)O[Ta](=O)=O
| CAS | 1314-61-0 |
|---|---|
| Molecular Weight (g/mol) | 441.89 |
| MDL Number | MFCD00011254 |
| SMILES | O=[Ta](=O)O[Ta](=O)=O |
| IUPAC Name | [(dioxotantalio)oxy]dioxotantalum |
| InChI Key | PBCFLUZVCVVTBY-UHFFFAOYSA-N |
| Molecular Formula | O5Ta2 |
Manganese(IV) oxide, 80-85%, powder
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Tantalum(V) chloride, 99.8% (metals basis)
CAS: 7721-01-9 Molecular Formula: Cl5Ta Molecular Weight (g/mol): 358.20 MDL Number: MFCD00011253 InChI Key: OEIMLTQPLAGXMX-UHFFFAOYSA-I Synonym: Tantalum pentachloride IUPAC Name: tantalum(5+) pentachloride SMILES: [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ta+5]
| CAS | 7721-01-9 |
|---|---|
| Molecular Weight (g/mol) | 358.20 |
| MDL Number | MFCD00011253 |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Ta+5] |
| Synonym | Tantalum pentachloride |
| IUPAC Name | tantalum(5+) pentachloride |
| InChI Key | OEIMLTQPLAGXMX-UHFFFAOYSA-I |
| Molecular Formula | Cl5Ta |
Copper(II) Oxide, Granular, For Elementary Analysis, MilliporeSigma™
CAS: 1317-38-0 Molecular Formula: CuO Molecular Weight (g/mol): 79.55 MDL Number: MFCD00010979 InChI Key: KKCXRELNMOYFLS-UHFFFAOYSA-N Synonym: cupric oxide,copper ii oxide,copper oxide,copper monoxide,banacobru ol,chrome brown,copper brown,copper monooxide,black copper oxide PubChem CID: 14829 IUPAC Name: copper(2+) oxidandiide SMILES: [O--].[Cu++]
| PubChem CID | 14829 |
|---|---|
| CAS | 1317-38-0 |
| Molecular Weight (g/mol) | 79.55 |
| MDL Number | MFCD00010979 |
| SMILES | [O--].[Cu++] |
| Synonym | cupric oxide,copper ii oxide,copper oxide,copper monoxide,banacobru ol,chrome brown,copper brown,copper monooxide,black copper oxide |
| IUPAC Name | copper(2+) oxidandiide |
| InChI Key | KKCXRELNMOYFLS-UHFFFAOYSA-N |
| Molecular Formula | CuO |
Platinum(II) chloride, 73% Pt
CAS: 10025-65-7 Molecular Formula: Cl2Pt Molecular Weight (g/mol): 265.98 MDL Number: MFCD00011181 InChI Key: CLSUSRZJUQMOHH-UHFFFAOYSA-L Synonym: Platinous chloride IUPAC Name: platinum(2+) dichloride SMILES: [Cl-].[Cl-].[Pt++]
| CAS | 10025-65-7 |
|---|---|
| Molecular Weight (g/mol) | 265.98 |
| MDL Number | MFCD00011181 |
| SMILES | [Cl-].[Cl-].[Pt++] |
| Synonym | Platinous chloride |
| IUPAC Name | platinum(2+) dichloride |
| InChI Key | CLSUSRZJUQMOHH-UHFFFAOYSA-L |
| Molecular Formula | Cl2Pt |
Copper(II) trifluoromethanesulfonate, 99%
CAS: 34946-82-2 Molecular Formula: CHCuF3O3S Molecular Weight (g/mol): 213.617 MDL Number: MFCD00077492 InChI Key: GZWXEFRPSWBAGC-UHFFFAOYSA-N Synonym: copper; trifluoromethanesulfonic acid PubChem CID: 45051791 IUPAC Name: copper;trifluoromethanesulfonic acid SMILES: C(F)(F)(F)S(=O)(=O)O.[Cu]
| PubChem CID | 45051791 |
|---|---|
| CAS | 34946-82-2 |
| Molecular Weight (g/mol) | 213.617 |
| MDL Number | MFCD00077492 |
| SMILES | C(F)(F)(F)S(=O)(=O)O.[Cu] |
| Synonym | copper; trifluoromethanesulfonic acid |
| IUPAC Name | copper;trifluoromethanesulfonic acid |
| InChI Key | GZWXEFRPSWBAGC-UHFFFAOYSA-N |
| Molecular Formula | CHCuF3O3S |
Cobalt(II) nitrate hexahydrate, 97.7% min
CAS: 10026-22-9 Molecular Formula: CoH12N2O12 Molecular Weight (g/mol): 291.03 MDL Number: MFCD00149647 InChI Key: QGUAJWGNOXCYJF-UHFFFAOYSA-N Synonym: cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate PubChem CID: 24821 ChEBI: CHEBI:86214 IUPAC Name: cobalt(2+);dinitrate;hexahydrate SMILES: O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24821 |
|---|---|
| CAS | 10026-22-9 |
| Molecular Weight (g/mol) | 291.03 |
| ChEBI | CHEBI:86214 |
| MDL Number | MFCD00149647 |
| SMILES | O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate |
| IUPAC Name | cobalt(2+);dinitrate;hexahydrate |
| InChI Key | QGUAJWGNOXCYJF-UHFFFAOYSA-N |
| Molecular Formula | CoH12N2O12 |
Silver nitrate solution, 0.1N, TitriPUR™, MilliporeSigma™
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
Mercury(II) oxide, yellow, Reagent Grade
CAS: 21908-53-2 Molecular Formula: HgO Molecular Weight (g/mol): 216.59 MDL Number: MFCD00011045 InChI Key: UKWHYYKOEPRTIC-UHFFFAOYSA-N Synonym: mercuric oxide,mercury ii oxide,mercury oxide,mercuric oxide, red,red mercuric oxide,mercuric oxide, yellow,santar,red precipitate,mercury monoxide IUPAC Name: oxomercury SMILES: O=[Hg]
| CAS | 21908-53-2 |
|---|---|
| Molecular Weight (g/mol) | 216.59 |
| MDL Number | MFCD00011045 |
| SMILES | O=[Hg] |
| Synonym | mercuric oxide,mercury ii oxide,mercury oxide,mercuric oxide, red,red mercuric oxide,mercuric oxide, yellow,santar,red precipitate,mercury monoxide |
| IUPAC Name | oxomercury |
| InChI Key | UKWHYYKOEPRTIC-UHFFFAOYSA-N |
| Molecular Formula | HgO |
Yttrium(III) oxalate nonahydrate, 99.9% (REO), Thermo Scientific Chemicals
CAS: 13266-82-5 Molecular Formula: C6H18O21Y2 Molecular Weight (g/mol): 604.001 MDL Number: MFCD00150502 InChI Key: CTXJKXXQOORSKU-UHFFFAOYSA-H PubChem CID: 131872179 IUPAC Name: oxalate;yttrium(3+);nonahydrate SMILES: C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].O.O.O.O.O.O.O.O.O.[Y+3].[Y+3]
| PubChem CID | 131872179 |
|---|---|
| CAS | 13266-82-5 |
| Molecular Weight (g/mol) | 604.001 |
| MDL Number | MFCD00150502 |
| SMILES | C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].O.O.O.O.O.O.O.O.O.[Y+3].[Y+3] |
| IUPAC Name | oxalate;yttrium(3+);nonahydrate |
| InChI Key | CTXJKXXQOORSKU-UHFFFAOYSA-H |
| Molecular Formula | C6H18O21Y2 |
Silver Nitrate, Crystal, BAKER ANALYZED™ A.C.S. Reagent, J.T. Baker™
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
| CAS | 13469-98-2 |
|---|---|
| MDL Number | MFCD00049710 |
Gold powder, spherical, APS 3.0-5.5 micron, 99.96+% (metals basis)
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |